C17H23ClN2O5S — CID 139247626
2-(chloromethyl)-4-(4-nitrophenyl)sulfonyl-1-oxa-4-azaspiro[5.6]dodecane (PubChem CID 139247626) has the molecular formula C17H23ClN2O5S and a molecular weight of 402.90 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(4-nitrophenyl)sulfonyl-1-oxa-4-azaspiro[5.6]dodecane.
| Compound Name | 2-(chloromethyl)-4-(4-nitrophenyl)sulfonyl-1-oxa-4-azaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 139247626 |
| Molecular Formula | C17H23ClN2O5S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-(chloromethyl)-4-(4-nitrophenyl)sulfonyl-1-oxa-4-azaspiro[5.6]dodecane |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CC(CCl)OC3(CCCCCC3)C2)cc1 |
| InChI | InChI=1S/C17H23ClN2O5S/c18-11-15-12-19(13-17(25-15)9-3-1-2-4-10-17)26(23,24)16-7-5-14(6-8-16)20(21)22/h5-8,15H,1-4,9-13H2 |
| InChIKey | HUNLEUGNHHYWFN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|