C25H45ClN2O7SSi2 — CID 135069396
tert-butyl-[[(6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(chloromethyl)-4-(4-nitrophenyl)sulfonylmorpholin-2-yl]methoxy]-dimethylsilane (PubChem CID 135069396) has the molecular formula C25H45ClN2O7SSi2 and a molecular weight of 609.33 g/mol. Its IUPAC name is tert-butyl-[[(6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(chloromethyl)-4-(4-nitrophenyl)sulfonylmorpholin-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(chloromethyl)-4-(4-nitrophenyl)sulfonylmorpholin-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135069396 |
| Molecular Formula | C25H45ClN2O7SSi2 |
| Molecular Weight | 609.33 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | tert-butyl-[[(6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(chloromethyl)-4-(4-nitrophenyl)sulfonylmorpholin-2-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1(CO[Si](C)(C)C(C)(C)C)CN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C[C@@H](CCl)O1 |
| InChI | InChI=1S/C25H45ClN2O7SSi2/c1-23(2,3)37(7,8)33-18-25(19-34-38(9,10)24(4,5)6)17-27(16-21(15-26)35-25)36(31,32)22-13-11-20(12-14-22)28(29)30/h11-14,21H,15-19H2,1-10H3/t21-/m1/s1 |
| InChIKey | FIRATGDUQGICRJ-OAQYLSRUSA-N |
| XLogP | 6.01 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.33 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|