C18H21N3O7S — CID 178167671
methyl 1-[4-(4-nitrophenyl)sulfonyl-8-oxo-4,7-diazaspiro[2.5]octan-7-yl]cyclobutane-1-carboxylate (PubChem CID 178167671) has the molecular formula C18H21N3O7S and a molecular weight of 423.45 g/mol. Its IUPAC name is methyl 1-[4-(4-nitrophenyl)sulfonyl-8-oxo-4,7-diazaspiro[2.5]octan-7-yl]cyclobutane-1-carboxylate.
| Compound Name | methyl 1-[4-(4-nitrophenyl)sulfonyl-8-oxo-4,7-diazaspiro[2.5]octan-7-yl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 178167671 |
| Molecular Formula | C18H21N3O7S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | methyl 1-[4-(4-nitrophenyl)sulfonyl-8-oxo-4,7-diazaspiro[2.5]octan-7-yl]cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(N2CCN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)C3(CC3)C2=O)CCC1 |
| InChI | InChI=1S/C18H21N3O7S/c1-28-16(23)18(7-2-8-18)19-11-12-20(17(9-10-17)15(19)22)29(26,27)14-5-3-13(4-6-14)21(24)25/h3-6H,2,7-12H2,1H3 |
| InChIKey | FRNUCNLBNSDZHJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|