C28H35N5O6S — CID 4207290
N-(cyclohexylmethyl)-2-[8-(4-nitrophenyl)sulfonyl-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 4207290) has the molecular formula C28H35N5O6S and a molecular weight of 569.68 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[8-(4-nitrophenyl)sulfonyl-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-(cyclohexylmethyl)-2-[8-(4-nitrophenyl)sulfonyl-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 4207290 |
| Molecular Formula | C28H35N5O6S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[8-(4-nitrophenyl)sulfonyl-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | O=C(CN1CN(c2ccccc2)C2(CCN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)CC2)C1=O)NCC1CCCCC1 |
| InChI | InChI=1S/C28H35N5O6S/c34-26(29-19-22-7-3-1-4-8-22)20-30-21-32(23-9-5-2-6-10-23)28(27(30)35)15-17-31(18-16-28)40(38,39)25-13-11-24(12-14-25)33(36)37/h2,5-6,9-14,22H,1,3-4,7-8,15-21H2,(H,29,34) |
| InChIKey | LFDFYYFEXGULCV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|