C27H33N5O6 — CID 42773672
N-(3-ethoxypropyl)-2-[8-(4-nitrobenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 42773672) has the molecular formula C27H33N5O6 and a molecular weight of 523.59 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[8-(4-nitrobenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-(3-ethoxypropyl)-2-[8-(4-nitrobenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 42773672 |
| Molecular Formula | C27H33N5O6 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[8-(4-nitrobenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CCOCCCNC(=O)CN1CN(c2ccccc2)C2(CCN(C(=O)c3ccc([N+](=O)[O-])cc3)CC2)C1=O |
| InChI | InChI=1S/C27H33N5O6/c1-2-38-18-6-15-28-24(33)19-30-20-31(22-7-4-3-5-8-22)27(26(30)35)13-16-29(17-14-27)25(34)21-9-11-23(12-10-21)32(36)37/h3-5,7-12H,2,6,13-20H2,1H3,(H,28,33) |
| InChIKey | SKVDNABAXAHPCK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|