C31H42N4O4 — CID 5025550
2-[8-(4-hexylbenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 5025550) has the molecular formula C31H42N4O4 and a molecular weight of 534.70 g/mol. Its IUPAC name is 2-[8-(4-hexylbenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[8-(4-hexylbenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 5025550 |
| Molecular Formula | C31H42N4O4 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | 2-[8-(4-hexylbenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCCCCCc1ccc(C(=O)N2CCC3(CC2)C(=O)N(CC(=O)NCCOC)CN3c2ccccc2)cc1 |
| InChI | InChI=1S/C31H42N4O4/c1-3-4-5-7-10-25-13-15-26(16-14-25)29(37)33-20-17-31(18-21-33)30(38)34(23-28(36)32-19-22-39-2)24-35(31)27-11-8-6-9-12-27/h6,8-9,11-16H,3-5,7,10,17-24H2,1-2H3,(H,32,36) |
| InChIKey | SZYUTNGFRYDGOJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|