C36H44N4O3 — CID 4609927
N-benzyl-2-[8-(4-hexylbenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-methylacetamide (PubChem CID 4609927) has the molecular formula C36H44N4O3 and a molecular weight of 580.77 g/mol. Its IUPAC name is N-benzyl-2-[8-(4-hexylbenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-methylacetamide.
| Compound Name | N-benzyl-2-[8-(4-hexylbenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 4609927 |
| Molecular Formula | C36H44N4O3 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | N-benzyl-2-[8-(4-hexylbenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-methylacetamide |
| SMILES | CCCCCCc1ccc(C(=O)N2CCC3(CC2)C(=O)N(CC(=O)N(C)Cc2ccccc2)CN3c2ccccc2)cc1 |
| InChI | InChI=1S/C36H44N4O3/c1-3-4-5-8-13-29-18-20-31(21-19-29)34(42)38-24-22-36(23-25-38)35(43)39(28-40(36)32-16-11-7-12-17-32)27-33(41)37(2)26-30-14-9-6-10-15-30/h6-7,9-12,14-21H,3-5,8,13,22-28H2,1-2H3 |
| InChIKey | LSTCBZBUFDBYLH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|