C19H22N2O10S — CID 175548093
3,4-diethyl-3-(3-methoxy-3-oxoprop-1-enyl)-1-(4-nitrophenyl)sulfonylazetidine-2,2-dicarboxylic acid (PubChem CID 175548093) has the molecular formula C19H22N2O10S and a molecular weight of 470.46 g/mol. Its IUPAC name is 3,4-diethyl-3-(3-methoxy-3-oxoprop-1-enyl)-1-(4-nitrophenyl)sulfonylazetidine-2,2-dicarboxylic acid.
| Compound Name | 3,4-diethyl-3-(3-methoxy-3-oxoprop-1-enyl)-1-(4-nitrophenyl)sulfonylazetidine-2,2-dicarboxylic acid |
|---|---|
| PubChem CID | 175548093 |
| Molecular Formula | C19H22N2O10S |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 3,4-diethyl-3-(3-methoxy-3-oxoprop-1-enyl)-1-(4-nitrophenyl)sulfonylazetidine-2,2-dicarboxylic acid |
| SMILES | CCC1N(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C(C(=O)O)(C(=O)O)C1(C=CC(=O)OC)CC |
| InChI | InChI=1S/C19H22N2O10S/c1-4-14-18(5-2,11-10-15(22)31-3)19(16(23)24,17(25)26)20(14)32(29,30)13-8-6-12(7-9-13)21(27)28/h6-11,14H,4-5H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | FXNCLZQXQHUKAB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 181.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|