C18H18N2O5S — CID 164685178
(3R,4R,5R)-4-methyl-1-(4-nitrophenyl)sulfonyl-5-phenylpyrrolidine-3-carbaldehyde (PubChem CID 164685178) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is (3R,4R,5R)-4-methyl-1-(4-nitrophenyl)sulfonyl-5-phenylpyrrolidine-3-carbaldehyde.
| Compound Name | (3R,4R,5R)-4-methyl-1-(4-nitrophenyl)sulfonyl-5-phenylpyrrolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 164685178 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (3R,4R,5R)-4-methyl-1-(4-nitrophenyl)sulfonyl-5-phenylpyrrolidine-3-carbaldehyde |
| SMILES | C[C@@H]1[C@@H](C=O)CN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H18N2O5S/c1-13-15(12-21)11-19(18(13)14-5-3-2-4-6-14)26(24,25)17-9-7-16(8-10-17)20(22)23/h2-10,12-13,15,18H,11H2,1H3/t13-,15-,18-/m1/s1 |
| InChIKey | NEJWCMZDWDFZTE-DDUZABMNSA-N |
| XLogP | 2.79 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|