C11H19N3O2S — CID 115276116
2,2-dimethyl-1-(1H-pyrrol-2-ylsulfonyl)piperidin-4-amine (PubChem CID 115276116) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 2,2-dimethyl-1-(1H-pyrrol-2-ylsulfonyl)piperidin-4-amine.
| Compound Name | 2,2-dimethyl-1-(1H-pyrrol-2-ylsulfonyl)piperidin-4-amine |
|---|---|
| PubChem CID | 115276116 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2,2-dimethyl-1-(1H-pyrrol-2-ylsulfonyl)piperidin-4-amine |
| SMILES | CC1(C)CC(N)CCN1S(=O)(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C11H19N3O2S/c1-11(2)8-9(12)5-7-14(11)17(15,16)10-4-3-6-13-10/h3-4,6,9,13H,5,7-8,12H2,1-2H3 |
| InChIKey | FTFDWSIZAPUBMN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |