C15H27+ — CID 12501691
1,2,3-tritert-butylcyclopropene (PubChem CID 12501691) has the molecular formula C15H27+ and a molecular weight of 207.38 g/mol. Its IUPAC name is 1,2,3-tritert-butylcyclopropene.
| Compound Name | 1,2,3-tritert-butylcyclopropene |
|---|---|
| PubChem CID | 12501691 |
| Molecular Formula | C15H27+ |
| Molecular Weight | 207.38 g/mol |
| Exact Mass | 207.21 |
| IUPAC Name | 1,2,3-tritert-butylcyclopropene |
| SMILES | CC(C)(C)c1c(C(C)(C)C)[c+]1C(C)(C)C |
| InChI | InChI=1S/C15H27/c1-13(2,3)10-11(14(4,5)6)12(10)15(7,8)9/h1-9H3/q+1 |
| InChIKey | LEHYSEAHPFQCKZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|