C13H20 — CID 101174423
1,4-ditert-butylcyclopenta-1,2,3-triene (PubChem CID 101174423) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 1,4-ditert-butylcyclopenta-1,2,3-triene.
| Compound Name | 1,4-ditert-butylcyclopenta-1,2,3-triene |
|---|---|
| PubChem CID | 101174423 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 1,4-ditert-butylcyclopenta-1,2,3-triene |
| SMILES | CC(C)(C)C1=C=C=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C13H20/c1-12(2,3)10-7-8-11(9-10)13(4,5)6/h9H2,1-6H3 |
| InChIKey | ILAZDXCVSJMHQA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |