C10H21N3 — CID 142489150
4,5-ditert-butyl-2,3-dihydro-1H-triazole (PubChem CID 142489150) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 4,5-ditert-butyl-2,3-dihydro-1H-triazole.
| Compound Name | 4,5-ditert-butyl-2,3-dihydro-1H-triazole |
|---|---|
| PubChem CID | 142489150 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 4,5-ditert-butyl-2,3-dihydro-1H-triazole |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)NNN1 |
| InChI | InChI=1S/C10H21N3/c1-9(2,3)7-8(10(4,5)6)12-13-11-7/h11-13H,1-6H3 |
| InChIKey | ZQQWWDSMNBKQJF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |