C14H25N — CID 20872205
2,3-ditert-butyl-6-methyl-1,4-dihydropyridine (PubChem CID 20872205) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 2,3-ditert-butyl-6-methyl-1,4-dihydropyridine.
| Compound Name | 2,3-ditert-butyl-6-methyl-1,4-dihydropyridine |
|---|---|
| PubChem CID | 20872205 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 2,3-ditert-butyl-6-methyl-1,4-dihydropyridine |
| SMILES | CC1=CCC(C(C)(C)C)=C(C(C)(C)C)N1 |
| InChI | InChI=1S/C14H25N/c1-10-8-9-11(13(2,3)4)12(15-10)14(5,6)7/h8,15H,9H2,1-7H3 |
| InChIKey | DTTAJBDFUFZZTG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |