C12H23NO — CID 169298192
4,5-ditert-butyl-3,6-dihydro-2H-1,3-oxazine (PubChem CID 169298192) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 4,5-ditert-butyl-3,6-dihydro-2H-1,3-oxazine.
| Compound Name | 4,5-ditert-butyl-3,6-dihydro-2H-1,3-oxazine |
|---|---|
| PubChem CID | 169298192 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 4,5-ditert-butyl-3,6-dihydro-2H-1,3-oxazine |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)NCOC1 |
| InChI | InChI=1S/C12H23NO/c1-11(2,3)9-7-14-8-13-10(9)12(4,5)6/h13H,7-8H2,1-6H3 |
| InChIKey | RZOXGZZNWURNCL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |