C11H20O — CID 176758268
3,4-ditert-butyl-2H-oxete (PubChem CID 176758268) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 3,4-ditert-butyl-2H-oxete.
| Compound Name | 3,4-ditert-butyl-2H-oxete |
|---|---|
| PubChem CID | 176758268 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 3,4-ditert-butyl-2H-oxete |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)OC1 |
| InChI | InChI=1S/C11H20O/c1-10(2,3)8-7-12-9(8)11(4,5)6/h7H2,1-6H3 |
| InChIKey | QREUNOCWAOGTSY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |