C17H33N — CID 20872193
2-butyl-5,6-ditert-butyl-1,2,3,4-tetrahydropyridine (PubChem CID 20872193) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is 2-butyl-5,6-ditert-butyl-1,2,3,4-tetrahydropyridine.
| Compound Name | 2-butyl-5,6-ditert-butyl-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 20872193 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | 2-butyl-5,6-ditert-butyl-1,2,3,4-tetrahydropyridine |
| SMILES | CCCCC1CCC(C(C)(C)C)=C(C(C)(C)C)N1 |
| InChI | InChI=1S/C17H33N/c1-8-9-10-13-11-12-14(16(2,3)4)15(18-13)17(5,6)7/h13,18H,8-12H2,1-7H3 |
| InChIKey | RVWWLKJXHOHGSX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |