C17H32N3+ — CID 15548608
(1S,4S,6R,10R)-6,10-dibutyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene (PubChem CID 15548608) has the molecular formula C17H32N3+ and a molecular weight of 278.46 g/mol. Its IUPAC name is (1S,4S,6R,10R)-6,10-dibutyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene.
| Compound Name | (1S,4S,6R,10R)-6,10-dibutyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene |
|---|---|
| PubChem CID | 15548608 |
| Molecular Formula | C17H32N3+ |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | (1S,4S,6R,10R)-6,10-dibutyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene |
| SMILES | CCCC[C@@H]1C[C@@H]2CC[C@H]3C[C@@H](CCCC)NC(=[N+]23)N1 |
| InChI | InChI=1S/C17H31N3/c1-3-5-7-13-11-15-9-10-16-12-14(8-6-4-2)19-17(18-13)20(15)16/h13-16H,3-12H2,1-2H3,(H,18,19)/p+1/t13-,14-,15+,16+/m1/s1 |
| InChIKey | YBKDGSNTJQTVEA-WCVJEAGWSA-O |
| XLogP | 2.99 |
| TPSA | 27.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|