C16H28N3O2+ — CID 71614668
4-[(1S,4R,6S,10R)-10-methyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-en-6-yl]butyl acetate (PubChem CID 71614668) has the molecular formula C16H28N3O2+ and a molecular weight of 294.42 g/mol. Its IUPAC name is 4-[(1S,4R,6S,10R)-10-methyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-en-6-yl]butyl acetate.
| Compound Name | 4-[(1S,4R,6S,10R)-10-methyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-en-6-yl]butyl acetate |
|---|---|
| PubChem CID | 71614668 |
| Molecular Formula | C16H28N3O2+ |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 4-[(1S,4R,6S,10R)-10-methyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-en-6-yl]butyl acetate |
| SMILES | CC(=O)OCCCC[C@H]1C[C@H]2CC[C@H]3C[C@@H](C)NC(=[N+]23)N1 |
| InChI | InChI=1S/C16H27N3O2/c1-11-9-14-6-7-15-10-13(18-16(17-11)19(14)15)5-3-4-8-21-12(2)20/h11,13-15H,3-10H2,1-2H3,(H,17,18)/p+1/t11-,13+,14+,15-/m1/s1 |
| InChIKey | WYRSWGILVHEHML-UQOMUDLDSA-O |
| XLogP | 1.36 |
| TPSA | 53.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|