C21H38ClN3O2 — CID 10692335
methyl (1S,4R,5R,6S,10R)-6-methyl-10-nonyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene-5-carboxylate chloride (PubChem CID 10692335) has the molecular formula C21H38ClN3O2 and a molecular weight of 400.01 g/mol. Its IUPAC name is methyl (1S,4R,5R,6S,10R)-6-methyl-10-nonyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene-5-carboxylate chloride.
| Compound Name | methyl (1S,4R,5R,6S,10R)-6-methyl-10-nonyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene-5-carboxylate chloride |
|---|---|
| PubChem CID | 10692335 |
| Molecular Formula | C21H38ClN3O2 |
| Molecular Weight | 400.01 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | methyl (1S,4R,5R,6S,10R)-6-methyl-10-nonyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene-5-carboxylate chloride |
| SMILES | CCCCCCCCC[C@@H]1C[C@@H]2CC[C@@H]3[C@H](C(=O)OC)[C@H](C)NC(=[N+]23)N1.[Cl-] |
| InChI | InChI=1S/C21H37N3O2.ClH/c1-4-5-6-7-8-9-10-11-16-14-17-12-13-18-19(20(25)26-3)15(2)22-21(23-16)24(17)18;/h15-19H,4-14H2,1-3H3,(H,22,23);1H/t15-,16+,17-,18+,19+;/m0./s1 |
| InChIKey | APDSWMDKCKGOBN-BMEKHTRRSA-N |
| XLogP | 0.17 |
| TPSA | 53.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.01 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|