C17H31NO5 — CID 24773540
dimethyl (2R,6R)-2,6-dibutyl-4-hydroxypiperidine-3,5-dicarboxylate (PubChem CID 24773540) has the molecular formula C17H31NO5 and a molecular weight of 329.44 g/mol. Its IUPAC name is dimethyl (2R,6R)-2,6-dibutyl-4-hydroxypiperidine-3,5-dicarboxylate.
| Compound Name | dimethyl (2R,6R)-2,6-dibutyl-4-hydroxypiperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 24773540 |
| Molecular Formula | C17H31NO5 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | dimethyl (2R,6R)-2,6-dibutyl-4-hydroxypiperidine-3,5-dicarboxylate |
| SMILES | CCCC[C@H]1N[C@H](CCCC)C(C(=O)OC)C(O)C1C(=O)OC |
| InChI | InChI=1S/C17H31NO5/c1-5-7-9-11-13(16(20)22-3)15(19)14(17(21)23-4)12(18-11)10-8-6-2/h11-15,18-19H,5-10H2,1-4H3/t11-,12-,13?,14?,15?/m1/s1 |
| InChIKey | GTEHKMWVFGPASX-ILDWOOSOSA-N |
| XLogP | 1.65 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |