C7H13NO2 — CID 15249125
methyl (2R,3S)-3-propylaziridine-2-carboxylate (PubChem CID 15249125) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is methyl (2R,3S)-3-propylaziridine-2-carboxylate.
| Compound Name | methyl (2R,3S)-3-propylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 15249125 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | methyl (2R,3S)-3-propylaziridine-2-carboxylate |
| SMILES | CCC[C@@H]1N[C@H]1C(=O)OC |
| InChI | InChI=1S/C7H13NO2/c1-3-4-5-6(8-5)7(9)10-2/h5-6,8H,3-4H2,1-2H3/t5-,6+/m0/s1 |
| InChIKey | UCSPMVVFSWSXSE-NTSWFWBYSA-N |
| XLogP | 0.30 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|