C16H18N2O4 — CID 134949680
methyl (1R,3R,3aR,6aS)-4,6-dioxo-1-(2-phenylethyl)-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 134949680) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is methyl (1R,3R,3aR,6aS)-4,6-dioxo-1-(2-phenylethyl)-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3R,3aR,6aS)-4,6-dioxo-1-(2-phenylethyl)-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 134949680 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | methyl (1R,3R,3aR,6aS)-4,6-dioxo-1-(2-phenylethyl)-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1N[C@H](CCc2ccccc2)[C@H]2C(=O)NC(=O)[C@H]21 |
| InChI | InChI=1S/C16H18N2O4/c1-22-16(21)13-12-11(14(19)18-15(12)20)10(17-13)8-7-9-5-3-2-4-6-9/h2-6,10-13,17H,7-8H2,1H3,(H,18,19,20)/t10-,11-,12-,13-/m1/s1 |
| InChIKey | SSMFUYVGLVBWMG-FDYHWXHSSA-N |
| XLogP | 0.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|