C14H17NO4 — CID 70987709
methyl 4-hydroxy-2-oxo-5-(2-phenylethyl)pyrrolidine-3-carboxylate (PubChem CID 70987709) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl 4-hydroxy-2-oxo-5-(2-phenylethyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 4-hydroxy-2-oxo-5-(2-phenylethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 70987709 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl 4-hydroxy-2-oxo-5-(2-phenylethyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1C(=O)NC(CCc2ccccc2)C1O |
| InChI | InChI=1S/C14H17NO4/c1-19-14(18)11-12(16)10(15-13(11)17)8-7-9-5-3-2-4-6-9/h2-6,10-12,16H,7-8H2,1H3,(H,15,17) |
| InChIKey | SOLALAZKADFVBZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|