C24H27NO5S — CID 101405239
dimethyl (2R,3S,4R,5R)-2-benzylsulfanylcarbonyl-5-(2-phenylethyl)pyrrolidine-3,4-dicarboxylate (PubChem CID 101405239) has the molecular formula C24H27NO5S and a molecular weight of 441.55 g/mol. Its IUPAC name is dimethyl (2R,3S,4R,5R)-2-benzylsulfanylcarbonyl-5-(2-phenylethyl)pyrrolidine-3,4-dicarboxylate.
| Compound Name | dimethyl (2R,3S,4R,5R)-2-benzylsulfanylcarbonyl-5-(2-phenylethyl)pyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101405239 |
| Molecular Formula | C24H27NO5S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | dimethyl (2R,3S,4R,5R)-2-benzylsulfanylcarbonyl-5-(2-phenylethyl)pyrrolidine-3,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)[C@H](C(=O)SCc2ccccc2)N[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C24H27NO5S/c1-29-22(26)19-18(14-13-16-9-5-3-6-10-16)25-21(20(19)23(27)30-2)24(28)31-15-17-11-7-4-8-12-17/h3-12,18-21,25H,13-15H2,1-2H3/t18-,19+,20+,21-/m1/s1 |
| InChIKey | JJYSBMMHAPRTKD-IVAOSVALSA-N |
| XLogP | 3.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|