C27H30N2O2 — CID 101209098
(4R,5R,6R)-1-benzyl-5-hydroxy-4,6-bis(2-phenylethyl)-1,3-diazinan-2-one (PubChem CID 101209098) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (4R,5R,6R)-1-benzyl-5-hydroxy-4,6-bis(2-phenylethyl)-1,3-diazinan-2-one.
| Compound Name | (4R,5R,6R)-1-benzyl-5-hydroxy-4,6-bis(2-phenylethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 101209098 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (4R,5R,6R)-1-benzyl-5-hydroxy-4,6-bis(2-phenylethyl)-1,3-diazinan-2-one |
| SMILES | O=C1N[C@H](CCc2ccccc2)[C@@H](O)[C@@H](CCc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C27H30N2O2/c30-26-24(18-16-21-10-4-1-5-11-21)28-27(31)29(20-23-14-8-3-9-15-23)25(26)19-17-22-12-6-2-7-13-22/h1-15,24-26,30H,16-20H2,(H,28,31)/t24-,25-,26-/m1/s1 |
| InChIKey | OJTUQIAWPGIQLB-TWJOJJKGSA-N |
| XLogP | 4.58 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |