C27H31N3O3 — CID 142101560
1-[(5-aminocyclohepta-1,3,5-trien-1-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-1,3-diazepan-2-one (PubChem CID 142101560) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is 1-[(5-aminocyclohepta-1,3,5-trien-1-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-1,3-diazepan-2-one.
| Compound Name | 1-[(5-aminocyclohepta-1,3,5-trien-1-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 142101560 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 1-[(5-aminocyclohepta-1,3,5-trien-1-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-1,3-diazepan-2-one |
| SMILES | NC1=CCC(CN2C(=O)NC(Cc3ccccc3)C(O)C(O)C2Cc2ccccc2)=CC=C1 |
| InChI | InChI=1S/C27H31N3O3/c28-22-13-7-12-21(14-15-22)18-30-24(17-20-10-5-2-6-11-20)26(32)25(31)23(29-27(30)33)16-19-8-3-1-4-9-19/h1-13,15,23-26,31-32H,14,16-18,28H2,(H,29,33) |
| InChIKey | SKDKEKWEONRMFB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |