C10H19NO4 — CID 139248502
ethyl (2S,3R)-2,3-dihydroxy-3-[(2S,3R)-3-propylaziridin-2-yl]propanoate (PubChem CID 139248502) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is ethyl (2S,3R)-2,3-dihydroxy-3-[(2S,3R)-3-propylaziridin-2-yl]propanoate.
| Compound Name | ethyl (2S,3R)-2,3-dihydroxy-3-[(2S,3R)-3-propylaziridin-2-yl]propanoate |
|---|---|
| PubChem CID | 139248502 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | ethyl (2S,3R)-2,3-dihydroxy-3-[(2S,3R)-3-propylaziridin-2-yl]propanoate |
| SMILES | CCC[C@H]1N[C@@H]1[C@@H](O)[C@H](O)C(=O)OCC |
| InChI | InChI=1S/C10H19NO4/c1-3-5-6-7(11-6)8(12)9(13)10(14)15-4-2/h6-9,11-13H,3-5H2,1-2H3/t6-,7+,8-,9+/m1/s1 |
| InChIKey | MUDRJFFNTZBHOB-XAVMHZPKSA-N |
| XLogP | -0.59 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|