C8H17N — CID 55299742
(2R,3S)-2,3-dipropylaziridine (PubChem CID 55299742) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is (2R,3S)-2,3-dipropylaziridine.
| Compound Name | (2R,3S)-2,3-dipropylaziridine |
|---|---|
| PubChem CID | 55299742 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | (2R,3S)-2,3-dipropylaziridine |
| SMILES | CCC[C@@H]1N[C@@H]1CCC |
| InChI | InChI=1S/C8H17N/c1-3-5-7-8(9-7)6-4-2/h7-9H,3-6H2,1-2H3/t7-,8+ |
| InChIKey | UNCRFBBLMFCLLD-OCAPTIKFSA-N |
| XLogP | 1.93 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|