About (2R,3S)-2,3-dipropylaziridine
(2R,3S)-2,3-dipropylaziridine (PubChem CID 55299742) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is (2R,3S)-2,3-dipropylaziridine.
Molecular Properties
| Compound Name | (2R,3S)-2,3-dipropylaziridine |
| PubChem CID | 55299742 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | (2R,3S)-2,3-dipropylaziridine |
| SMILES | CCC[C@@H]1N[C@@H]1CCC |
| InChI | InChI=1S/C8H17N/c1-3-5-7-8(9-7)6-4-2/h7-9H,3-6H2,1-2H3/t7-,8+ |
| InChIKey | UNCRFBBLMFCLLD-OCAPTIKFSA-N |
| XLogP | 1.93 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-2,3-dipropylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2,3-dipropylaziridine?
The IUPAC name of (2R,3S)-2,3-dipropylaziridine (CID 55299742) is (2R,3S)-2,3-dipropylaziridine.
What is the SMILES notation for (2R,3S)-2,3-dipropylaziridine?
The canonical SMILES for (2R,3S)-2,3-dipropylaziridine is CCC[C@@H]1N[C@@H]1CCC.
What is the InChIKey of (2R,3S)-2,3-dipropylaziridine?
The InChIKey is UNCRFBBLMFCLLD-OCAPTIKFSA-N. The full InChI is InChI=1S/C8H17N/c1-3-5-7-8(9-7)6-4-2/h7-9H,3-6H2,1-2H3/t7-,8+.
What are the key properties of (2R,3S)-2,3-dipropylaziridine?
(2R,3S)-2,3-dipropylaziridine has a molecular weight of 127.23 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2,3-dipropylaziridine is sourced from PubChem (CID 55299742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).