C9H20N2 — CID 131195713
3,5-dimethyl-2-propylpiperazine (PubChem CID 131195713) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 3,5-dimethyl-2-propylpiperazine.
| Compound Name | 3,5-dimethyl-2-propylpiperazine |
|---|---|
| PubChem CID | 131195713 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 3,5-dimethyl-2-propylpiperazine |
| SMILES | CCCC1NCC(C)NC1C |
| InChI | InChI=1S/C9H20N2/c1-4-5-9-8(3)11-7(2)6-10-9/h7-11H,4-6H2,1-3H3 |
| InChIKey | WFOFWIGMLOYHHV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |