C8H18N2 — CID 134277914
2,6,7-trimethyl-1,4-diazepane (PubChem CID 134277914) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 2,6,7-trimethyl-1,4-diazepane.
| Compound Name | 2,6,7-trimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 134277914 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 2,6,7-trimethyl-1,4-diazepane |
| SMILES | CC1CNCC(C)C(C)N1 |
| InChI | InChI=1S/C8H18N2/c1-6-4-9-5-7(2)10-8(6)3/h6-10H,4-5H2,1-3H3 |
| InChIKey | NAGWCCHIEXLKFW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |