About 2,6-dimethylpiperazine;iodomethane
2,6-dimethylpiperazine;iodomethane (PubChem CID 177002631) has the molecular formula C7H17IN2
and a molecular weight of 256.13 g/mol. Its IUPAC name is 2,6-dimethylpiperazine;iodomethane.
Molecular Properties
| Compound Name | 2,6-dimethylpiperazine;iodomethane |
| PubChem CID | 177002631 |
| Molecular Formula | C7H17IN2 |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2,6-dimethylpiperazine;iodomethane |
| SMILES | CC1CNCC(C)N1.CI |
| InChI | InChI=1S/C6H14N2.CH3I/c1-5-3-7-4-6(2)8-5;1-2/h5-8H,3-4H2,1-2H3;1H3 |
| InChIKey | FXAQBSRSLMNFOJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylpiperazine;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylpiperazine;iodomethane?
The IUPAC name of 2,6-dimethylpiperazine;iodomethane (CID 177002631) is 2,6-dimethylpiperazine;iodomethane.
What is the SMILES notation for 2,6-dimethylpiperazine;iodomethane?
The canonical SMILES for 2,6-dimethylpiperazine;iodomethane is CC1CNCC(C)N1.CI.
What is the InChIKey of 2,6-dimethylpiperazine;iodomethane?
The InChIKey is FXAQBSRSLMNFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.CH3I/c1-5-3-7-4-6(2)8-5;1-2/h5-8H,3-4H2,1-2H3;1H3.
What are the key properties of 2,6-dimethylpiperazine;iodomethane?
2,6-dimethylpiperazine;iodomethane has a molecular weight of 256.13 g/mol, XLogP of 1.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylpiperazine;iodomethane is sourced from PubChem (CID 177002631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).