C5H11N — CID 154523082
(3R)-2,3-dimethylazetidine (PubChem CID 154523082) has the molecular formula C5H11N and a molecular weight of 85.15 g/mol. Its IUPAC name is (3R)-2,3-dimethylazetidine.
| Compound Name | (3R)-2,3-dimethylazetidine |
|---|---|
| PubChem CID | 154523082 |
| Molecular Formula | C5H11N |
| Molecular Weight | 85.15 g/mol |
| Exact Mass | 85.09 |
| IUPAC Name | (3R)-2,3-dimethylazetidine |
| SMILES | CC1NC[C@H]1C |
| InChI | InChI=1S/C5H11N/c1-4-3-6-5(4)2/h4-6H,3H2,1-2H3/t4-,5?/m1/s1 |
| InChIKey | BMVHDBKYVGUEIX-CNZKWPKMSA-N |
| XLogP | 0.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 85.15 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |