C4H10ClNO — CID 134691791
(2R,3S)-2-methylazetidin-3-ol;hydrochloride (PubChem CID 134691791) has the molecular formula C4H10ClNO and a molecular weight of 123.58 g/mol. Its IUPAC name is (2R,3S)-2-methylazetidin-3-ol;hydrochloride.
| Compound Name | (2R,3S)-2-methylazetidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 134691791 |
| Molecular Formula | C4H10ClNO |
| Molecular Weight | 123.58 g/mol |
| Exact Mass | 123.05 |
| IUPAC Name | (2R,3S)-2-methylazetidin-3-ol;hydrochloride |
| SMILES | C[C@H]1NC[C@@H]1O.Cl |
| InChI | InChI=1S/C4H9NO.ClH/c1-3-4(6)2-5-3;/h3-6H,2H2,1H3;1H/t3-,4+;/m1./s1 |
| InChIKey | VGWXJFDIRONLQP-HJXLNUONSA-N |
| XLogP | -0.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.58 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |