C6H9Cl2N — CID 58605767
(1S,2R,5R)-6,6-dichloro-2-methyl-3-azabicyclo[3.1.0]hexane (PubChem CID 58605767) has the molecular formula C6H9Cl2N and a molecular weight of 166.05 g/mol. Its IUPAC name is (1S,2R,5R)-6,6-dichloro-2-methyl-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,2R,5R)-6,6-dichloro-2-methyl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 58605767 |
| Molecular Formula | C6H9Cl2N |
| Molecular Weight | 166.05 g/mol |
| Exact Mass | 165.01 |
| IUPAC Name | (1S,2R,5R)-6,6-dichloro-2-methyl-3-azabicyclo[3.1.0]hexane |
| SMILES | C[C@H]1NC[C@H]2[C@@H]1C2(Cl)Cl |
| InChI | InChI=1S/C6H9Cl2N/c1-3-5-4(2-9-3)6(5,7)8/h3-5,9H,2H2,1H3/t3-,4+,5-/m1/s1 |
| InChIKey | VXRWZQNTBDYFNF-MROZADKFSA-N |
| XLogP | 1.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.05 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|