C7H12NNaO3S — CID 169053030
sodium (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-sulfonate (PubChem CID 169053030) has the molecular formula C7H12NNaO3S and a molecular weight of 213.23 g/mol. Its IUPAC name is sodium (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-sulfonate.
| Compound Name | sodium (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-sulfonate |
|---|---|
| PubChem CID | 169053030 |
| Molecular Formula | C7H12NNaO3S |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | sodium (1R,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-sulfonate |
| SMILES | CC1(C)[C@@H]2C(S(=O)(=O)[O-])NC[C@@H]21.[Na+] |
| InChI | InChI=1S/C7H13NO3S.Na/c1-7(2)4-3-8-6(5(4)7)12(9,10)11;/h4-6,8H,3H2,1-2H3,(H,9,10,11);/q;+1/p-1/t4-,5-,6?;/m0./s1 |
| InChIKey | VHBJAACWNUGGKA-GMOHXZSCSA-M |
| XLogP | -3.26 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|