C6H13NO2S — CID 155290058
(2R,3R)-2-methyl-3-(methylsulfonylmethyl)azetidine (PubChem CID 155290058) has the molecular formula C6H13NO2S and a molecular weight of 163.24 g/mol. Its IUPAC name is (2R,3R)-2-methyl-3-(methylsulfonylmethyl)azetidine.
| Compound Name | (2R,3R)-2-methyl-3-(methylsulfonylmethyl)azetidine |
|---|---|
| PubChem CID | 155290058 |
| Molecular Formula | C6H13NO2S |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | (2R,3R)-2-methyl-3-(methylsulfonylmethyl)azetidine |
| SMILES | C[C@H]1NC[C@H]1CS(C)(=O)=O |
| InChI | InChI=1S/C6H13NO2S/c1-5-6(3-7-5)4-10(2,8)9/h5-7H,3-4H2,1-2H3/t5-,6+/m1/s1 |
| InChIKey | HNYWLFBFDMEHNC-RITPCOANSA-N |
| XLogP | -0.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |