About N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide
N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide (PubChem CID 175950904) has the molecular formula C8H16N2O2S
and a molecular weight of 204.29 g/mol. Its IUPAC name is N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide |
| PubChem CID | 175950904 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide |
| SMILES | C[C@H]1NC[C@@H]1CS(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C8H16N2O2S/c1-6-7(4-9-6)5-13(11,12)10-8-2-3-8/h6-10H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | ZXMQWROXAXUIEW-RNFRBKRXSA-N |
| XLogP | -0.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide?
The IUPAC name of N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide (CID 175950904) is N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide.
What is the SMILES notation for N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide?
The canonical SMILES for N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide is C[C@H]1NC[C@@H]1CS(=O)(=O)NC1CC1.
What is the InChIKey of N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide?
The InChIKey is ZXMQWROXAXUIEW-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H16N2O2S/c1-6-7(4-9-6)5-13(11,12)10-8-2-3-8/h6-10H,2-5H2,1H3/t6-,7-/m1/s1.
What are the key properties of N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide?
N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide has a molecular weight of 204.29 g/mol, XLogP of -0.32, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-1-[(2R,3S)-2-methylazetidin-3-yl]methanesulfonamide is sourced from PubChem (CID 175950904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).