C5H11NO2S — CID 175984932
(2R,3S)-2-methyl-3-methylsulfonylazetidine (PubChem CID 175984932) has the molecular formula C5H11NO2S and a molecular weight of 149.21 g/mol. Its IUPAC name is (2R,3S)-2-methyl-3-methylsulfonylazetidine.
| Compound Name | (2R,3S)-2-methyl-3-methylsulfonylazetidine |
|---|---|
| PubChem CID | 175984932 |
| Molecular Formula | C5H11NO2S |
| Molecular Weight | 149.21 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | (2R,3S)-2-methyl-3-methylsulfonylazetidine |
| SMILES | C[C@H]1NC[C@@H]1S(C)(=O)=O |
| InChI | InChI=1S/C5H11NO2S/c1-4-5(3-6-4)9(2,7)8/h4-6H,3H2,1-2H3/t4-,5+/m1/s1 |
| InChIKey | CBVSYXGSPRVVJP-UHNVWZDZSA-N |
| XLogP | -0.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.21 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |