C9H15N2O2- — CID 174243631
(1R,2S,5S)-N,6,6-trimethyl-N-oxido-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 174243631) has the molecular formula C9H15N2O2- and a molecular weight of 183.23 g/mol. Its IUPAC name is (1R,2S,5S)-N,6,6-trimethyl-N-oxido-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N,6,6-trimethyl-N-oxido-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 174243631 |
| Molecular Formula | C9H15N2O2- |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (1R,2S,5S)-N,6,6-trimethyl-N-oxido-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CN([O-])C(=O)[C@H]1NC[C@H]2[C@@H]1C2(C)C |
| InChI | InChI=1S/C9H15N2O2/c1-9(2)5-4-10-7(6(5)9)8(12)11(3)13/h5-7,10H,4H2,1-3H3/q-1/t5-,6-,7-/m0/s1 |
| InChIKey | VMBXTVAJGXAEFA-ACZMJKKPSA-N |
| XLogP | 0.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|