C8H12ClNO — CID 168878796
6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl chloride (PubChem CID 168878796) has the molecular formula C8H12ClNO and a molecular weight of 173.64 g/mol. Its IUPAC name is 6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl chloride.
| Compound Name | 6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl chloride |
|---|---|
| PubChem CID | 168878796 |
| Molecular Formula | C8H12ClNO |
| Molecular Weight | 173.64 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl chloride |
| SMILES | CC1(C)C2CNC(C(=O)Cl)C21 |
| InChI | InChI=1S/C8H12ClNO/c1-8(2)4-3-10-6(5(4)8)7(9)11/h4-6,10H,3H2,1-2H3 |
| InChIKey | UJTNLSHGDKRJHD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.64 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|