C15H26N4O2 — CID 167481479
N-[1-amino-2-(2-oxopiperidin-3-yl)ethyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 167481479) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[1-amino-2-(2-oxopiperidin-3-yl)ethyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | N-[1-amino-2-(2-oxopiperidin-3-yl)ethyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 167481479 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N-[1-amino-2-(2-oxopiperidin-3-yl)ethyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC1(C)C2CNC(C(=O)NC(N)CC3CCCNC3=O)C21 |
| InChI | InChI=1S/C15H26N4O2/c1-15(2)9-7-18-12(11(9)15)14(21)19-10(16)6-8-4-3-5-17-13(8)20/h8-12,18H,3-7,16H2,1-2H3,(H,17,20)(H,19,21) |
| InChIKey | BYRLXKDMQAKCMA-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|