C15H23N3O3 — CID 175890945
N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide (PubChem CID 175890945) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 175890945 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
| SMILES | O=C[C@H](C[C@@H]1CCNC1=O)NC(=O)C1NCC2CCCC21 |
| InChI | InChI=1S/C15H23N3O3/c19-8-11(6-9-4-5-16-14(9)20)18-15(21)13-12-3-1-2-10(12)7-17-13/h8-13,17H,1-7H2,(H,16,20)(H,18,21)/t9-,10?,11-,12?,13?/m0/s1 |
| InChIKey | IJVBPULEBLVEDX-NIMGSEGYSA-N |
| XLogP | -0.42 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|