C24H29Cl2N3O5 — CID 166964338
(3aS,6aR)-2-[2-(2,4-dichlorophenoxy)propanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 166964338) has the molecular formula C24H29Cl2N3O5 and a molecular weight of 510.42 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-(2,4-dichlorophenoxy)propanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3aS,6aR)-2-[2-(2,4-dichlorophenoxy)propanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 166964338 |
| Molecular Formula | C24H29Cl2N3O5 |
| Molecular Weight | 510.42 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | (3aS,6aR)-2-[2-(2,4-dichlorophenoxy)propanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)N1C[C@@H]2CCC[C@@H]2C1C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
| InChI | InChI=1S/C24H29Cl2N3O5/c1-13(34-20-6-5-16(25)10-19(20)26)24(33)29-11-15-3-2-4-18(15)21(29)23(32)28-17(12-30)9-14-7-8-27-22(14)31/h5-6,10,12-15,17-18,21H,2-4,7-9,11H2,1H3,(H,27,31)(H,28,32)/t13?,14-,15-,17-,18-,21?/m0/s1 |
| InChIKey | LEIVLQTWUZVFLY-KTBSTJCNSA-N |
| XLogP | 2.60 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|