C25H29Cl2N5O3 — CID 175448050
(3S)-N-[(1S)-1-cyano-2-(2-oxopyrrolidin-3-yl)ethyl]-2-[1-(2,4-dichlorophenyl)azetidine-3-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 175448050) has the molecular formula C25H29Cl2N5O3 and a molecular weight of 518.45 g/mol. Its IUPAC name is (3S)-N-[(1S)-1-cyano-2-(2-oxopyrrolidin-3-yl)ethyl]-2-[1-(2,4-dichlorophenyl)azetidine-3-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S)-N-[(1S)-1-cyano-2-(2-oxopyrrolidin-3-yl)ethyl]-2-[1-(2,4-dichlorophenyl)azetidine-3-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 175448050 |
| Molecular Formula | C25H29Cl2N5O3 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | (3S)-N-[(1S)-1-cyano-2-(2-oxopyrrolidin-3-yl)ethyl]-2-[1-(2,4-dichlorophenyl)azetidine-3-carbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | N#C[C@H](CC1CCNC1=O)NC(=O)[C@@H]1C2CCCC2CN1C(=O)C1CN(c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C25H29Cl2N5O3/c26-17-4-5-21(20(27)9-17)31-11-16(12-31)25(35)32-13-15-2-1-3-19(15)22(32)24(34)30-18(10-28)8-14-6-7-29-23(14)33/h4-5,9,14-16,18-19,22H,1-3,6-8,11-13H2,(H,29,33)(H,30,34)/t14?,15?,18-,19?,22-/m0/s1 |
| InChIKey | TTXWITAHQWKNPE-YBQQZYFZSA-N |
| XLogP | 2.59 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |