C25H31Cl2N3O5 — CID 166964294
(3S,3aS)-2-[2-(2,4-dichlorophenoxy)-2-methylpropanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 166964294) has the molecular formula C25H31Cl2N3O5 and a molecular weight of 524.45 g/mol. Its IUPAC name is (3S,3aS)-2-[2-(2,4-dichlorophenoxy)-2-methylpropanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S,3aS)-2-[2-(2,4-dichlorophenoxy)-2-methylpropanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 166964294 |
| Molecular Formula | C25H31Cl2N3O5 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | (3S,3aS)-2-[2-(2,4-dichlorophenoxy)-2-methylpropanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CC(C)(Oc1ccc(Cl)cc1Cl)C(=O)N1CC2CCC[C@@H]2[C@H]1C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
| InChI | InChI=1S/C25H31Cl2N3O5/c1-25(2,35-20-7-6-16(26)11-19(20)27)24(34)30-12-15-4-3-5-18(15)21(30)23(33)29-17(13-31)10-14-8-9-28-22(14)32/h6-7,11,13-15,17-18,21H,3-5,8-10,12H2,1-2H3,(H,28,32)(H,29,33)/t14-,15?,17-,18-,21-/m0/s1 |
| InChIKey | YHSIPOCMDDQOQG-KBUSCETASA-N |
| XLogP | 2.99 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|