C24H31N3O5 — CID 166964402
(3aS,6aR)-2-[3-(3-hydroxyphenyl)propanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 166964402) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is (3aS,6aR)-2-[3-(3-hydroxyphenyl)propanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3aS,6aR)-2-[3-(3-hydroxyphenyl)propanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 166964402 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (3aS,6aR)-2-[3-(3-hydroxyphenyl)propanoyl]-N-[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | O=C[C@H](C[C@@H]1CCNC1=O)NC(=O)C1[C@H]2CCC[C@H]2CN1C(=O)CCc1cccc(O)c1 |
| InChI | InChI=1S/C24H31N3O5/c28-14-18(12-16-9-10-25-23(16)31)26-24(32)22-20-6-2-4-17(20)13-27(22)21(30)8-7-15-3-1-5-19(29)11-15/h1,3,5,11,14,16-18,20,22,29H,2,4,6-10,12-13H2,(H,25,31)(H,26,32)/t16-,17-,18-,20-,22?/m0/s1 |
| InChIKey | VINDACCOLFBNRO-BVTNYVNESA-N |
| XLogP | 1.16 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|