C24H29FN4O6 — CID 167338868
(3S,3aS,6aR)-2-[2-(2-fluoroanilino)-2-oxoacetyl]-N-[(2S)-4-hydroxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 167338868) has the molecular formula C24H29FN4O6 and a molecular weight of 488.52 g/mol. Its IUPAC name is (3S,3aS,6aR)-2-[2-(2-fluoroanilino)-2-oxoacetyl]-N-[(2S)-4-hydroxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S,3aS,6aR)-2-[2-(2-fluoroanilino)-2-oxoacetyl]-N-[(2S)-4-hydroxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 167338868 |
| Molecular Formula | C24H29FN4O6 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (3S,3aS,6aR)-2-[2-(2-fluoroanilino)-2-oxoacetyl]-N-[(2S)-4-hydroxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1F)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)CO |
| InChI | InChI=1S/C24H29FN4O6/c25-16-6-1-2-7-17(16)27-23(34)24(35)29-11-14-4-3-5-15(14)20(29)22(33)28-18(19(31)12-30)10-13-8-9-26-21(13)32/h1-2,6-7,13-15,18,20,30H,3-5,8-12H2,(H,26,32)(H,27,34)(H,28,33)/t13-,14-,15-,18-,20-/m0/s1 |
| InChIKey | FEPYTDPOYPBFMC-DUUCEYBISA-N |
| XLogP | -0.04 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|