C25H27Cl2FN4O5 — CID 166936477
2-(4,7-dichloro-5-fluoro-1H-indole-2-carbonyl)-N-[4-hydroxy-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 166936477) has the molecular formula C25H27Cl2FN4O5 and a molecular weight of 553.42 g/mol. Its IUPAC name is 2-(4,7-dichloro-5-fluoro-1H-indole-2-carbonyl)-N-[4-hydroxy-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | 2-(4,7-dichloro-5-fluoro-1H-indole-2-carbonyl)-N-[4-hydroxy-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 166936477 |
| Molecular Formula | C25H27Cl2FN4O5 |
| Molecular Weight | 553.42 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 2-(4,7-dichloro-5-fluoro-1H-indole-2-carbonyl)-N-[4-hydroxy-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | O=C1NCCC1CC(NC(=O)C1C2CCCC2CN1C(=O)c1cc2c(Cl)c(F)cc(Cl)c2[nH]1)C(=O)CO |
| InChI | InChI=1S/C25H27Cl2FN4O5/c26-15-8-16(28)20(27)14-7-18(30-21(14)15)25(37)32-9-12-2-1-3-13(12)22(32)24(36)31-17(19(34)10-33)6-11-4-5-29-23(11)35/h7-8,11-13,17,22,30,33H,1-6,9-10H2,(H,29,35)(H,31,36) |
| InChIKey | LFLSGGRYLZDHHW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|