C32H35ClN4O5 — CID 166936946
(1S,3aR,7aS)-2-(4-chloro-6-phenyl-1H-indole-2-carbonyl)-N-[4-hydroxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxamide (PubChem CID 166936946) has the molecular formula C32H35ClN4O5 and a molecular weight of 591.11 g/mol. Its IUPAC name is (1S,3aR,7aS)-2-(4-chloro-6-phenyl-1H-indole-2-carbonyl)-N-[4-hydroxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxamide.
| Compound Name | (1S,3aR,7aS)-2-(4-chloro-6-phenyl-1H-indole-2-carbonyl)-N-[4-hydroxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 166936946 |
| Molecular Formula | C32H35ClN4O5 |
| Molecular Weight | 591.11 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | (1S,3aR,7aS)-2-(4-chloro-6-phenyl-1H-indole-2-carbonyl)-N-[4-hydroxy-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxamide |
| SMILES | O=C(CO)C(C[C@@H]1CCNC1=O)NC(=O)[C@@H]1[C@H]2CCCC[C@H]2CN1C(=O)c1cc2c(Cl)cc(-c3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C32H35ClN4O5/c33-24-12-21(18-6-2-1-3-7-18)14-25-23(24)15-27(35-25)32(42)37-16-20-8-4-5-9-22(20)29(37)31(41)36-26(28(39)17-38)13-19-10-11-34-30(19)40/h1-3,6-7,12,14-15,19-20,22,26,29,35,38H,4-5,8-11,13,16-17H2,(H,34,40)(H,36,41)/t19-,20-,22-,26?,29-/m0/s1 |
| InChIKey | VVIBIMXNCSSFEX-QZAUUBLZSA-N |
| XLogP | 3.69 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.11 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |